|
|
| | 2,5-Dimethoxybenzoic acid Basic information |
| Product Name: | 2,5-Dimethoxybenzoic acid | | Synonyms: | RARECHEM AL BO 0325;GENTISIC ACID DIMETHYL ETHER;2,5-DIMETHOXYBENZOIC ACID;2,5-dimethoxybenzoate;2,5-Dimethoxybenzoic;2,5-DIMETHHOXYBENZOICACID;2,5-DIMETHOXYBENZOIC ACID, 98+%;DIMETHOXYBENZOIC ACID, 2,5-(RG) | | CAS: | 2785-98-0 | | MF: | C9H10O4 | | MW: | 182.17 | | EINECS: | 220-503-0 | | Product Categories: | Organic acids;C9;Carbonyl Compounds;Carboxylic Acids;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts | | Mol File: | 2785-98-0.mol |  |
| | 2,5-Dimethoxybenzoic acid Chemical Properties |
| Melting point | 76-78 °C (lit.) | | Boiling point | 275.56°C (rough estimate) | | density | 1.2481 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.97±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 2097993 | | InChI | InChI=1S/C9H10O4/c1-12-6-3-4-8(13-2)7(5-6)9(10)11/h3-5H,1-2H3,(H,10,11) | | InChIKey | NYJBTJMNTNCTCP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(OC)=CC=C1OC | | LogP | 1.281 (est) | | CAS DataBase Reference | 2785-98-0(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 2,5-dimethoxy-(2785-98-0) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 37/39-26-36/37-36 | | WGK Germany | 3 | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,5-Dimethoxybenzoic acid Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Uses | 2,5-Dimethoxybenzoic acid has been used in synthesis of:
- galbulimima alkaloid GB 13
- 3,4-dihydrofluoren-2(1H)-ones via reductive alkylation
| | Synthesis Reference(s) | Journal of Medicinal Chemistry, 20, p. 414, 1977 DOI: 10.1021/jm00213a020 |
| | 2,5-Dimethoxybenzoic acid Preparation Products And Raw materials |
|