NEOBAICALEIN manufacturers
- NEOBAICALEIN
-
-
2026-07-06
- CAS:55084-08-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kgs
- scullcapflavone II
-
- $9.80
-
2020-01-10
- CAS:55084-08-7
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | NEOBAICALEIN Basic information |
| Product Name: | NEOBAICALEIN | | Synonyms: | 2',5-Dihydroxy-6,6',7,8-tetramethoxyflavone;Skullcapflavon II;scullcapflavone II;NEOBAICALEIN;4H-1-Benzopyran-4-one, 5-hydroxy-2-(2-hydroxy-6-methoxyphenyl)-6,7,8-trimethoxy-;Skullcapflavone II >=90% (LC/MS-UV);inhibit,inflammatory,Skullcapflavone II,Bacterial,antimicrobial,mycobacterial,differentiation,Inhibitor,osteoclast,flavonoid;Skullcapflavone II, 10 mM in DMSO | | CAS: | 55084-08-7 | | MF: | C19H18O8 | | MW: | 374.34 | | EINECS: | | | Product Categories: | Hexa-substituted Flavones | | Mol File: | 55084-08-7.mol |  |
| | NEOBAICALEIN Chemical Properties |
| Boiling point | 636.9±55.0 °C(Predicted) | | density | 1.375±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder | | pka | 6.81±0.40(Predicted) | | color | Yellow | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | InChI=1S/C19H18O8/c1-23-11-7-5-6-9(20)13(11)12-8-10(21)14-15(22)17(24-2)19(26-4)18(25-3)16(14)27-12/h5-8,20,22H,1-4H3 | | InChIKey | GMQFOKBGMKVUQZ-UHFFFAOYSA-N | | SMILES | C1(C2=C(OC)C=CC=C2O)OC2=C(OC)C(OC)=C(OC)C(O)=C2C(=O)C=1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | NEOBAICALEIN Usage And Synthesis |
| Chemical Properties | White crystals, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Schisandra chinensis. | | Uses | Skullcapflavone II is derived from Scutellaria baicalensis, inhibitis ovalbumin-induced airway inflammation in a mouse model of asthma. | | Definition | ChEBI: A tetramethoxyflavone that is flavone substituted by methoxy groups at positions 6, 7, 8 and 6' and hydroxy groups at positons 5 and 2' respectively. | | in vivo | Skullcapflavone II, a potential bradykinin antagonist, reduces the major pathophysiological features of allergic asthma, at least in part by acting on TGF-β1/Smad signaling pathways[3]. | | target | TGF-β/Smad | COX |
| | NEOBAICALEIN Preparation Products And Raw materials |
|