|
|
| | 2,3-DIPHENYLPROPIONIC ACID Basic information |
| Product Name: | 2,3-DIPHENYLPROPIONIC ACID | | Synonyms: | 2,3-diphenylpropanoicacid;2,3-DIPHENYLPROPIONIC ACID;2,3-Diphenylpropionic acid, 95%(gc);2,3-DIPHENYLPROPIONIC ACID 98+%;α-Phenylbenzenepropionic acid;BENZYLPHENYL ACETIC ACID;NSC49;(2S)-2,3-diphenylpropanoic acid | | CAS: | 3333-15-1 | | MF: | C15H14O2 | | MW: | 226.28 | | EINECS: | 222-065-6 | | Product Categories: | Organic acids | | Mol File: | 3333-15-1.mol |  |
| | 2,3-DIPHENYLPROPIONIC ACID Chemical Properties |
| Melting point | 89°C | | Boiling point | 340 °C | | density | 1.161±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.18±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C15H14O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,16,17) | | InChIKey | PCRICPYPVZKEBZ-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)(C(=O)O)CC1C=CC=CC=1 |
| | 2,3-DIPHENYLPROPIONIC ACID Usage And Synthesis |
| Chemical Properties | White solid | | Synthesis Reference(s) | Journal of the American Chemical Society, 78, p. 4942, 1956 DOI: 10.1021/ja01600a035 |
| | 2,3-DIPHENYLPROPIONIC ACID Preparation Products And Raw materials |
|