| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
(R)-N-Boc-2-amino-3,3-diphenylpropionic acid manufacturers
|
| | (R)-N-Boc-2-amino-3,3-diphenylpropionic acid Basic information |
| | (R)-N-Boc-2-amino-3,3-diphenylpropionic acid Chemical Properties |
| Melting point | 157 °C (dec.)(lit.) | | Boiling point | 502.7±50.0 °C(Predicted) | | density | 1.167±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.68±0.10(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]20/D 29.5°, c = 1 in ethanol | | Major Application | peptide synthesis | | InChI | 1S/C20H23NO4/c1-20(2,3)25-19(24)21-17(18(22)23)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16-17H,1-3H3,(H,21,24)(H,22,23)/t17-/m1/s1 | | InChIKey | TYJDOLCFYZSNQC-QGZVFWFLSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](C(c1ccccc1)c2ccccc2)C(O)=O | | CAS DataBase Reference | 143060-31-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | (R)-N-Boc-2-amino-3,3-diphenylpropionic acid Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | (R)-N-Boc-2-amino-3,3-diphenylpropionic acid Preparation Products And Raw materials |
|