| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- L-Lys(cbz)-Ome.Hcl
-
-
2026-09-16
- CAS:27894-50-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- H-LYS(Z)-OME HCL
-
- $6658.00
-
2025-12-24
- CAS: 27894-50-4
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 1T
- H-LYS(Z)-OME HCL
-
- $1.00
-
2019-07-06
- CAS:27894-50-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | H-Lys(Z)-OMe HCl Basic information |
| Product Name: | H-Lys(Z)-OMe HCl | | Synonyms: | H-LYS(Z)-OME HYDROCHLORIDE;N-EPSILON-BENZYLOXYCARBONYL-L-LYSINE METHYL ESTER HYDROCHLORIDE SALT;N(EPSILON)-CBZ-L-LYSINE METHYL ESTER HYDROCHLORIDE;N-EPSILON-CBZ-L-LYS METHYL ESTER HCL;N-EPSILON-CARBOBENZOXY-L-LYSINE METHYL ESTER HYDROCHLORIDE;N-EPSILON-Z-L-LYSINE METHYL ESTER HYDROCHLORIDE;H-Lys(Z)-OMe.HCI;Nε-Z-L-lysine methyl ester hydrochloride | | CAS: | 27894-50-4 | | MF: | C15H23ClN2O4 | | MW: | 330.81 | | EINECS: | 248-715-9 | | Product Categories: | Amino Acids and Derivatives;Amino Acid Derivatives;Amino Acids | | Mol File: | 27894-50-4.mol |  |
| | H-Lys(Z)-OMe HCl Chemical Properties |
| Melting point | 115-118°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | color | White to off-white | | Optical Rotation | [α]20/D +14.5±0.5°, c = 2% in H2O | | BRN | 3578476 | | Major Application | peptide synthesis | | InChI | 1S/C15H22N2O4.ClH/c1-20-14(18)13(16)9-5-6-10-17-15(19)21-11-12-7-3-2-4-8-12;/h2-4,7-8,13H,5-6,9-11,16H2,1H3,(H,17,19);1H/t13-;/m0./s1 | | InChIKey | QPNJISLOYQGQTI-ZOWNYOTGSA-N | | SMILES | Cl.COC(=O)[C@@H](N)CCCCNC(=O)OCc1ccccc1 | | CAS DataBase Reference | 27894-50-4(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | H-Lys(Z)-OMe HCl Usage And Synthesis |
| Chemical Properties | White powder | | Uses | H-Lys(Z)-OMe Hydrochloride is a reagent in the development of human calcitonin gene-related peptide (CGRP) receptor antagonists for treatment of acute migraine. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-Lys(Z)-OMe HCl Preparation Products And Raw materials |
|