- N6-Cbz-L-Lysine
-
-
2026-09-11
- CAS:1155-64-2
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- N6-Cbz-L-Lysine
-
- $2.00
-
2026-08-25
- CAS:1155-64-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- N6-Cbz-L-Lysine
-
-
2025-12-24
- CAS:1155-64-2
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000 tons
|
| | N6-Cbz-L-Lysine Chemical Properties |
| Melting point | 259 °C (dec.)(lit.) | | alpha | 14.4 º (c=1.6 in 1N HCl) | | Boiling point | 423.04°C (rough estimate) | | density | 1.1429 (rough estimate) | | refractive index | 16 ° (C=1.6, 2mol/L HCl) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Aqueous Base, Dilute Acid | | pka | 2.53±0.24(Predicted) | | form | Powder | | color | White to off-white | | Optical Rotation | [α]20/D +15.5±1°, c = 1% in 1 M HCl | | BRN | 2222482 | | Major Application | peptide synthesis | | InChI | InChI=1S/C14H20N2O4/c15-12(13(17)18)8-4-5-9-16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m0/s1 | | InChIKey | CKGCFBNYQJDIGS-LBPRGKRZSA-N | | SMILES | C(O)(=O)[C@H](CCCCNC(OCC1=CC=CC=C1)=O)N | | CAS DataBase Reference | 1155-64-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | N6-Cbz-L-Lysine Usage And Synthesis |
| Synthesis | The conventional synthetic method for N6-Cbz-L-lysine starts with the corresponding configuration of lysine and an acyl chloride from another segment, reacting the amino group and the acyl chloride to generate the corresponding amide to obtain the target product N6-Cbz-L-lysine. This route requires the addition of an external base as an acid-binding agent, such as sodium hydroxide. 
| | Chemical Properties | white to off-white powder | | Uses | Protected amino acid | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N6-Cbz-L-Lysine Preparation Products And Raw materials |
|