| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Bromo-2-fluoro-1-(trifluoromethoxy)benzene Basic information |
| Product Name: | 4-Bromo-2-fluoro-1-(trifluoromethoxy)benzene | | Synonyms: | bromofluorotrifluoromethoxybenzene;4-(Trifluoromethoxy)-3-fluorobromobenzene;1-Bromo-3-fluoro-4-(trifluoromethoxy)benzene;1-Brom-3-fluor-4-trifluormethoxybenzol;2-Fluoro-4-bromotrifluoromethoxybenzene;4-Bromo-2-fluoro-1-(trifluoromethoxy)benzene;4-Bromo-2-fluoro-1-(trifluoromethoxy);1-Bromo-3-fluoro-4-(trifluoromethoxy)benzene, 4-Bromo-alpha,alpha,alpha,2-tetrafluoroanisole, 4-Bromo-2-fluorophenyl trifluoromethyl ether | | CAS: | 105529-58-6 | | MF: | C7H3BrF4O | | MW: | 259 | | EINECS: | 430-850-1 | | Product Categories: | Aromatic Halides (substituted) | | Mol File: | 105529-58-6.mol |  |
| | 4-Bromo-2-fluoro-1-(trifluoromethoxy)benzene Chemical Properties |
| Melting point | -55.5°C | | Boiling point | 78°C 48mm | | density | 1.71g/ml | | vapor pressure | 4 hPa ( 25 °C) | | refractive index | 1.4470 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C7H3BrF4O/c8-4-1-2-6(5(9)3-4)13-7(10,11)12/h1-3H | | InChIKey | SBSFDYRKNUCGBZ-UHFFFAOYSA-N | | SMILES | C1(OC(F)(F)F)=CC=C(Br)C=C1F | | CAS DataBase Reference | 105529-58-6(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-37 | | WGK Germany | WGK 2 | | Autoignition Temperature | 630°C | | HS Code | 29093090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Inhalation
Aquatic Acute 1
Aquatic Chronic 1
Skin Irrit. 2 |
| | 4-Bromo-2-fluoro-1-(trifluoromethoxy)benzene Usage And Synthesis |
| Chemical Properties | Pale yellow liquid |
| | 4-Bromo-2-fluoro-1-(trifluoromethoxy)benzene Preparation Products And Raw materials |
|