4-Methyl-6-phenylpyrimidin-2-amine manufacturers
|
| | 4-Methyl-6-phenylpyrimidin-2-amine Basic information |
| Product Name: | 4-Methyl-6-phenylpyrimidin-2-amine | | Synonyms: | 4-Methyl-6-phenyl-2-pyrimidinamine;Albb-005380;4-methyl-6-phenylpyrimidin-2-amine(SALTDATA: FREE);CHEMBRDG-BB 4012253;2-Amino-4-phenyl-6-methylpyrimidine;2-Pyrimidinamine, 4-methyl-6-phenyl-;4-METHYL-6-PHENYLPYRIMIDIN-2-AMINE ISO 9001:2015 REACH;4-Methyl-6-phenylpyrimidin-2-amine | | CAS: | 15755-15-4 | | MF: | C11H11N3 | | MW: | 185.23 | | EINECS: | | | Product Categories: | | | Mol File: | 15755-15-4.mol |  |
| | 4-Methyl-6-phenylpyrimidin-2-amine Chemical Properties |
| Melting point | 172-173 °C | | Boiling point | 400.0±48.0 °C(Predicted) | | density | 1.159±0.06 g/cm3(Predicted) | | form | solid | | pka | 4.27±0.10(Predicted) | | InChI | InChI=1S/C11H11N3/c1-8-7-10(14-11(12)13-8)9-5-3-2-4-6-9/h2-7H,1H3,(H2,12,13,14) | | InChIKey | ZWHPURVKWJBWEF-UHFFFAOYSA-N | | SMILES | C1(N)=NC(C2=CC=CC=C2)=CC(C)=N1 |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-Methyl-6-phenylpyrimidin-2-amine Usage And Synthesis |
| | 4-Methyl-6-phenylpyrimidin-2-amine Preparation Products And Raw materials |
|