|
|
| | Fmoc-N-methyl-L-aspartic acid 4-tert-butyl ester Basic information |
| | Fmoc-N-methyl-L-aspartic acid 4-tert-butyl ester Chemical Properties |
| Melting point | 135-140°C | | Boiling point | 598.7±50.0 °C(Predicted) | | density | 1.237±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in water or 1% acetic acid | | form | Powder | | pka | 3.59±0.23(Predicted) | | color | White to off-white | | Optical Rotation | [α]22/D -39.0°, c = 0.5% in DMF | | Major Application | peptide synthesis | | InChI | InChI=1S/C24H27NO6/c1-24(2,3)31-21(26)13-20(22(27)28)25(4)23(29)30-14-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h5-12,19-20H,13-14H2,1-4H3,(H,27,28)/t20-/m0/s1 | | InChIKey | CYWWLVIEAOUXGW-FQEVSTJZSA-N | | SMILES | C(O)(=O)[C@H](CC(OC(C)(C)C)=O)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C | | CAS DataBase Reference | 152548-66-8(CAS DataBase Reference) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Fmoc-N-methyl-L-aspartic acid 4-tert-butyl ester Usage And Synthesis |
| Chemical Properties | White to off-white solid | | Uses | Fmoc protected N-methyl amino acid suitable for solid phase peptide synthesis. N-methyl amino acids have been shown to improve proteolytic stability of peptides. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-N-methyl-L-aspartic acid 4-tert-butyl ester Preparation Products And Raw materials |
|