5,10,15,20-TETRAPHENYL-21H,23H-PORPHINE NICKEL(II) manufacturers
|
| | 5,10,15,20-TETRAPHENYL-21H,23H-PORPHINE NICKEL(II) Basic information |
| Product Name: | 5,10,15,20-TETRAPHENYL-21H,23H-PORPHINE NICKEL(II) | | Synonyms: | [5,10,15,20-Tetraphenylporphinato(2-)]nickel;[meso-Tetraphenylporphinato(2-)]nickel;21H,23H-Porphine, 5,10,15,20-tetraphenyl-, nickel complex;Nickel tetraphenylporphine;Nickel tetraphenylporphyrin;Nickel(II) 5,10,15,20-tetraphenylporphine;Nickel(II) tetraphenylphorphyrin;Nickel, [5,10,15,20-tetraphenyl-21H,23H-porphinato(2-)-N21,N22,N23,N24]-, (SP-4-1)- | | CAS: | 14172-92-0 | | MF: | C44H28N4Ni | | MW: | 671.41 | | EINECS: | | | Product Categories: | metal porphine (porphyrin) complex;Porphyrins;Synthetic Porphyrins | | Mol File: | 14172-92-0.mol |  |
| | 5,10,15,20-TETRAPHENYL-21H,23H-PORPHINE NICKEL(II) Chemical Properties |
| Melting point | >300 °C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | crystal | | color | purple | | Water Solubility | Insoluble in H2O; soluble in CHCl3; slightly soluble in ether, benzene, hexane, and methanol. | | λmax | 525 nm (2nd) | | InChIKey | CXIRWLOIAQYBLZ-DAJBKUBHSA-N | | SMILES | N12[Ni]N3C4C=CC3=C(C3C=CC(N=3)=C(C3=CC=CC=C3)C1=CC=C2C(C1=CC=CC=C1)=C1C=CC(C=4C2=CC=CC=C2)=N1)C1=CC=CC=C1 |c:7,14,41,t:36| |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 37/39-26-36 | | WGK Germany | 3 | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| Provider | Language |
|
ACROS
| English |
| | 5,10,15,20-TETRAPHENYL-21H,23H-PORPHINE NICKEL(II) Usage And Synthesis |
| Chemical Properties | dark purple crystalline powder or crystals | | Uses | Nickel(II) Tetraphenylporphyrinate is an electron transfer agent and catalyst for aryl halogen exchange reactions. It could be used in cyclizations of saturated ο-iodo ketones and hydrogenation of alkenes.
| | reaction suitability | reagent type: catalyst
core: nickel | | Purification Methods | Purify it by chromatography on neutral (Grade I) alumina, followed by recrystallisation from CH2Cl2/MeOH [Yamashita J Phys Chem 91 3055 1987]. [Beilstein 26 III/IV 1960.] | | Precautions | Stable in air and water. Some nickel compounds are known carcinogens, so standard safety precautions apply.
|
| | 5,10,15,20-TETRAPHENYL-21H,23H-PORPHINE NICKEL(II) Preparation Products And Raw materials |
|