|
|
| | (S)-(-)-1,1-DIPHENYL-2-AMINOPROPANE Basic information |
| Product Name: | (S)-(-)-1,1-DIPHENYL-2-AMINOPROPANE | | Synonyms: | (S)-1,1-Diphenyl-2-propanamine;(S)-1,1-Diphenylpropan-2-aMine;(S)-(-)-1,1-DIPHENYL-2-AMINOPROPANE;(S)-1,1-DIPHENYL-2-AMINOPROPANE;(S)-1-METHYL-2,2-DIPHENYL-ETHYLAMINE;(S)-(-)-2-AMINO-1,1-DIPHENYLPROPANE;Benzeneethanamine, .alpha.-methyl-.beta.-phenyl-, (.alpha.S)-;(S)-(-)-1,1-Diphenyl-2-aminopropane 97% | | CAS: | 67659-37-4 | | MF: | C15H17N | | MW: | 211.3 | | EINECS: | | | Product Categories: | Amines;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 67659-37-4.mol |  |
| | (S)-(-)-1,1-DIPHENYL-2-AMINOPROPANE Chemical Properties |
| Melting point | 78-82 °C(lit.) | | Boiling point | 324.2±11.0 °C(Predicted) | | density | 1.022±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 9.21±0.10(Predicted) | | Optical Rotation | [α]20/D 16°, c = 1 in chloroform | | InChI | 1S/C15H17N/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15H,16H2,1H3/t12-/m0/s1 | | InChIKey | XNKICCFGYSXSAI-LBPRGKRZSA-N | | SMILES | C[C@H](N)C(c1ccccc1)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(-)-1,1-DIPHENYL-2-AMINOPROPANE Usage And Synthesis |
| Uses | (S)-(;)-1,1-Diphenyl-2-aminopropane can be used as a model amine compound in the chirality sensing studies by organic probes using circular dichroism technique. |
| | (S)-(-)-1,1-DIPHENYL-2-AMINOPROPANE Preparation Products And Raw materials |
|