|
|
| | Tetraethylene glycol dimethacrylate Basic information |
| Product Name: | Tetraethylene glycol dimethacrylate | | Synonyms: | 2-Propenoicacid,2-methyl-,oxybis(2,1-ethanediyloxy-2,1-ethanediyl)ester;METHACRYLIC ACID TETRAETHYLENE GLYCOL DIESTER;3,6,9-trioxaundecamethylene dimethacrylate;PEG-4 DIMETHACRYLATE;TETRAETHYLENE GLYCOL DIMETHACRYLATE, STA B.;TEGdimethacrylat;Tetraethyleneglycoldimethacrylat;3,6,9-Trioxaundecamethylendimethacrylat | | CAS: | 109-17-1 | | MF: | C16H26O7 | | MW: | 330.37 | | EINECS: | 203-653-1 | | Product Categories: | monomer | | Mol File: | 109-17-1.mol |  |
| | Tetraethylene glycol dimethacrylate Chemical Properties |
| Melting point | 220℃ | | Boiling point | 220°C | | density | 1.082 g/mL at 20 °C(lit.) | | vapor pressure | 0Pa at 20℃ | | refractive index | n20/D 1.463 | | Fp | 196°C | | storage temp. | -20°C | | solubility | soluble in Methanol | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | 12.6g/L at 20℃ | | BRN | 1803537 | | Cosmetics Ingredients Functions | FILM FORMING BINDING | | Cosmetic Ingredient Review (CIR) | Tetraethylene glycol dimethacrylate (109-17-1) | | InChI | 1S/C16H26O7/c1-13(2)15(17)22-11-9-20-7-5-19-6-8-21-10-12-23-16(18)14(3)4/h1,3,5-12H2,2,4H3 | | InChIKey | LTHJXDSHSVNJKG-UHFFFAOYSA-N | | SMILES | C=C(C)C(OCCOCCOCCOCCOC(C(C)=C)=O)=O | | LogP | 2.04 at 40℃ | | CAS DataBase Reference | 109-17-1(CAS DataBase Reference) | | EPA Substance Registry System | Tetraethylene glycol dimethacrylate (109-17-1) |
| Safety Statements | 23-24/25 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 1 | | RTECS | OZ4000000 | | TSCA | TSCA listed | | HS Code | 2916.14.2050 | | REACH Registrations | Active | | Storage Class | 10 - Combustible liquids | | Toxicity | LD50 skin in rabbit: > 3gm/kg |
| | Tetraethylene glycol dimethacrylate Usage And Synthesis |
| Description | Tetraethylene glycol dimethacrylate is a crosslinking
agent of acrylic resins, employed to optimize the
dilution of high-viscosity monomers and to link
together the macromolecules costituting the polymer,
to make their three-dimentional structure more rigid.
Occupational dermatitis was reported in a dental
technician. | | Chemical Properties | Water-white to pale-straw liquid. Insoluble in water;
soluble in styrene, many esters, and aromatics;
limited solubility in aliphatic hydrocarbons. Combustible. | | Uses | Plasticizer. | | Uses | methacrylate present in adhesives; in polyethyleneglycol dimethacrylate in Loctite anaerobic sealants. | | Uses | High purity PEG dimethacrylates are commonly used in PEG-based hydrogels and crosslinking hydrophilic polymers. | | Hazard | Irritant to skin and eyes. | | reaction suitability | reagent type: cross-linking reagent |
| | Tetraethylene glycol dimethacrylate Preparation Products And Raw materials |
|