| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Cyclopentylboronic acid Basic information |
| | Cyclopentylboronic acid Chemical Properties |
| Melting point | 126 °C (dec.)(lit.) | | Boiling point | 235.0±23.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 10.47±0.20(Predicted) | | form | Crystalline Powder or Flakes | | color | White to off-white | | InChI | InChI=1S/C5H11BO2/c7-6(8)5-3-1-2-4-5/h5,7-8H,1-4H2 | | InChIKey | VTTDFSNKIMAQTB-UHFFFAOYSA-N | | SMILES | C1CCCC1B(O)O | | CAS DataBase Reference | 63076-51-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | Cyclopentylboronic acid Usage And Synthesis |
| Chemical Properties | Off-white powder | | Uses | Reactant involved in:
- Cross coupling reactions with quinones or aromatic amines
- Arylation and alkylation of diphenylisoxazole
- Ruphos-mediated Suzuki cross coupling reactions
|
| | Cyclopentylboronic acid Preparation Products And Raw materials |
|