|
|
| | 5-(Carbobenzoxyamino)valeric acid Basic information |
| Product Name: | 5-(Carbobenzoxyamino)valeric acid | | Synonyms: | N-[(Benzyloxy)carbonyl]-5-aminopentanoic acid;Z-5-Ava-OH;5-(Benzyloxycarbonylamino)valeric acid;5-[[(phenylmethoxy)carbonyl]amino]- Pentanoic acid;5-BENZYLOXYCARBONYLAMINO-PENTANOIC ACID;5-(CARBOBENZOXYAMINO)VALERIC ACID, 98+%(T);5-(Carbobenzoxyamino)pentanoic Acid
N-Cbz-5-aminovaleric Acid
N-Cbz-5-aminopentanoic Acid;delta-Carbobenzoxyaminovaleric acid | | CAS: | 23135-50-4 | | MF: | C13H17NO4 | | MW: | 251.28 | | EINECS: | | | Product Categories: | | | Mol File: | 23135-50-4.mol |  |
| | 5-(Carbobenzoxyamino)valeric acid Chemical Properties |
| Melting point | 106 °C | | Boiling point | 459.9±38.0 °C(Predicted) | | density | 1.186±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.72±0.10(Predicted) | | form | Solid | | color | Off-white | | InChI | InChI=1S/C13H17NO4/c15-12(16)8-4-5-9-14-13(17)18-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2,(H,14,17)(H,15,16) | | InChIKey | QYYPKLYDFCYGPG-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCNC(OCC1=CC=CC=C1)=O |
| | 5-(Carbobenzoxyamino)valeric acid Usage And Synthesis |
| Uses | 5-(Carbobenzoxyamino)valeric acid is commonly used as a protected building block in peptide synthesis and medicinal chemistry, utilizing the CBZ group to shield the primary amine during reactions. |
| | 5-(Carbobenzoxyamino)valeric acid Preparation Products And Raw materials |
|