|
|
| | Nonane-4,6-dione Basic information |
| Product Name: | Nonane-4,6-dione | | Synonyms: | AKOS MSC-0382;4,6-Nonanedione;4,6-Nonanedione,99%;Nonane-4,6-dione ,99%;Nonane-4,6-dione | | CAS: | 14090-88-1 | | MF: | C9H16O2 | | MW: | 156.22 | | EINECS: | 237-938-7 | | Product Categories: | | | Mol File: | 14090-88-1.mol |  |
| | Nonane-4,6-dione Chemical Properties |
| Melting point | -46 °C | | Boiling point | 79-81°C 8mm | | density | 0.9181 g/cm3(Temp: 16 °C) | | pka | 9.56±0.10(Predicted) | | InChI | InChI=1S/C9H16O2/c1-3-5-8(10)7-9(11)6-4-2/h3-7H2,1-2H3 | | InChIKey | ZDYWPVCQPUPOJV-UHFFFAOYSA-N | | SMILES | CCCC(=O)CC(=O)CCC | | EPA Substance Registry System | 4,6-Nonanedione (14090-88-1) |
| TSCA | TSCA listed | | HS Code | 2914199090 |
| | Nonane-4,6-dione Usage And Synthesis |
| Uses | Nonane-4,6-dione can be useful in the study of gene pvaB and oxidized polyvinyl alcohol hydrolase of Pseudomonas sp. strain VM15C. | | Definition | ChEBI: A nonanone carrying oxo substituents at positions 4 and 6 respectively. |
| | Nonane-4,6-dione Preparation Products And Raw materials |
|