| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Bis(3,5-di-tert-butyl-4-methoxyphenyl)chlorophosphine Basic information |
| Product Name: | Bis(3,5-di-tert-butyl-4-methoxyphenyl)chlorophosphine | | Synonyms: | BIS(3,5-DI-TERT-BUTYL-4-METHOXYPHENYL)PHOSPHINOUS CHLORIDE;Bis(3,5-di-t-butyl-4-methoxyphenyl)chlorophosphine,;Bis(3,5-di-t-butyl-4-methoxyphenyl)chlorophosphine,93%;Bis[3,5-bis(1,1-dimethylethyl)-4-methoxyphenyl]phosphinous chloride;chloro-bis(3,5-ditert-butyl-4-methoxyphenyl)phosphane;Phosphinous chloride, P,P-bis[3,5-bis(1,1-dimethylethyl)-4-methoxyphenyl]-;Bis(3,5-di-tert-butyl-4-methoxyphenyl)chlorophosphine;Bis(3,5-di-tert-butyl-4-methoxyphenyl)chlorophosphine | | CAS: | 212713-08-1 | | MF: | C30H46ClO2P | | MW: | 505.11 | | EINECS: | 633-650-4 | | Product Categories: | Catalysis and Inorganic Chemistry;Phosphorus Compounds;Phosphorus Precursors | | Mol File: | 212713-08-1.mol |  |
| | Bis(3,5-di-tert-butyl-4-methoxyphenyl)chlorophosphine Chemical Properties |
| Melting point | 116-120 °C | | Boiling point | 552.5±50.0 °C(Predicted) | | form | solid | | Water Solubility | Reacts with water. | | Sensitive | Air & Moisture Sensitive | | InChI | 1S/C30H46ClO2P/c1-27(2,3)21-15-19(16-22(25(21)32-13)28(4,5)6)34(31)20-17-23(29(7,8)9)26(33-14)24(18-20)30(10,11)12/h15-18H,1-14H3 | | InChIKey | VOGHMZHRQUWLRE-UHFFFAOYSA-N | | SMILES | COc1c(cc(cc1C(C)(C)C)P(Cl)c2cc(c(OC)c(c2)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| Hazard Codes | F | | Risk Statements | 11 | | RIDADR | UN3261 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Flam. Sol. 2 |
| | Bis(3,5-di-tert-butyl-4-methoxyphenyl)chlorophosphine Usage And Synthesis |
| Uses | It is used as a reactant for asymmetric hydrogenation with iridium catalysts, chemo selective reaction with deprotonated 2-hydoxy-3,3,N-trimethylbutanamide. It is also used as a reactant for synthesis of phosphine- containing amino acids and peptide-based catalyst ligands, nonracemic phosphine-containing amino acids for palladium- catalyzed asymmetric allylic substitution reactions. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | Bis(3,5-di-tert-butyl-4-methoxyphenyl)chlorophosphine Preparation Products And Raw materials |
|