| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Bis(4-methoxyphenyl)chlorophosphine Basic information |
| Product Name: | Bis(4-methoxyphenyl)chlorophosphine | | Synonyms: | Chlorobis(4-methoxyphenyl)phosphine, 98+%;Chlorobis(4-methoxyphenyl)phosphine;chloro-bis(4-methoxyphenyl)phosphane;P,P-Bis(4-methoxyphenyl)phosphinous chloride;Phosphinous chloride, P,P-bis(4-methoxyphenyl)-;Bis(4-methoxyphenyl)phosphinouschloride;Bis(4-methoxyphenyl)chlorophosphine | | CAS: | 13685-30-8 | | MF: | C14H14ClO2P | | MW: | 280.69 | | EINECS: | | | Product Categories: | | | Mol File: | 13685-30-8.mol |  |
| | Bis(4-methoxyphenyl)chlorophosphine Chemical Properties |
| Melting point | 61-64℃ | | Boiling point | 140°C/1.5mm | | Fp | 140°C/1.5mm | | form | solid | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | InChI | 1S/C14H14ClO2P/c1-16-11-3-7-13(8-4-11)18(15)14-9-5-12(17-2)6-10-14/h3-10H,1-2H3 | | InChIKey | YTFQUBRFOJIJOZ-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1)P(Cl)c2ccc(OC)cc2 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN3265 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Bis(4-methoxyphenyl)chlorophosphine Usage And Synthesis |
| Uses | Chlorobis(4-methoxyphenyl)phosphine is used an pharmaceutical intermediate. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | Bis(4-methoxyphenyl)chlorophosphine Preparation Products And Raw materials |
|