| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine Basic information |
| Product Name: | Bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine | | Synonyms: | Chlorobis(3,5-dimethyl-4-methoxyphenyl)phosphine, 98+%;Bis(3,5-diMethyl-4-Methoxyphenyl)chlorophosphine,Min.98%;chloro-bis(4-methoxy-3,5-dimethylphenyl)phosphane;Phosphinous chloride, P,P-bis(4-methoxy-3,5-dimethylphenyl)-;Bis(3,5-dimethyl-4-methoxyphenyl)phosphinouschloride;Bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine | | CAS: | 136802-85-2 | | MF: | C18H22ClO2P | | MW: | 336.79 | | EINECS: | | | Product Categories: | organophosphine ligand | | Mol File: | 136802-85-2.mol |  |
| | Bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine Chemical Properties |
| Boiling point | 451.7±45.0 °C(Predicted) | | density | 1.141 g/cm3 at 25 °C | | refractive index | n20/D1.597 | | Fp | >110℃ | | form | liquid | | color | colorless, viscous | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C18H22ClO2P/c1-11-7-15(8-12(2)17(11)20-5)22(19)16-9-13(3)18(21-6)14(4)10-16/h7-10H,1-6H3 | | InChIKey | JWCZKGYRAINWJA-UHFFFAOYSA-N | | SMILES | P(C1=CC(C)=C(OC)C(C)=C1)(C1=CC(C)=C(OC)C(C)=C1)Cl |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-43-45 | | RIDADR | UN3265 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine Usage And Synthesis |
| Uses | Reactant for:
- Asymmetric organocatalytic electrophilic phosphination
- Asymmetric hydroformulation using Taddol-based chiral phosphine-phosphite ligands
- Synthesis of ferrocene-based chiral diphosphines
- Alcoholysis of phosphane-boranes
- Asymmetric hydrogenations of bifep-type biferrocenes
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | Bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine Preparation Products And Raw materials |
|