|
|
| | 6-Chloro-1-hydroxibenzotriazol Basic information |
| | 6-Chloro-1-hydroxibenzotriazol Chemical Properties |
| Melting point | 197 °C | | Boiling point | 379.5±34.0 °C(Predicted) | | density | 1.71±0.1 g/cm3(Predicted) | | Fp | 198°C | | storage temp. | Store at R.T. | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 6.69±0.58(Predicted) | | Appearance | Off-white to light yellow Solid | | Decomposition | 198 ºC | | Stability: | Possibly Shock Sensitive | | InChI | InChI=1S/C6H4ClN3O/c7-4-1-2-5-6(3-4)10(11)9-8-5/h1-3,11H | | InChIKey | TZCYLJGNWDVJRA-UHFFFAOYSA-N | | SMILES | N1(O)C2=CC(Cl)=CC=C2N=N1 | | CAS DataBase Reference | 26198-19-6(CAS DataBase Reference) |
| | 6-Chloro-1-hydroxibenzotriazol Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 1-Hydroxy-6-chlorobenzotriazole (Wetted with > 10% water) is used in preparation of Fusidic acid A cycloaminothiazole derivative. |
| | 6-Chloro-1-hydroxibenzotriazol Preparation Products And Raw materials |
|