| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Di-tert-butylphenylphosphonium tetrafluoroborate Basic information |
| Product Name: | Di-tert-butylphenylphosphonium tetrafluoroborate | | Synonyms: | Di-tert-butylphenylphosphonium tetrafluoroborate,99%;Bis(1,1-dimethylethyl)(phenyl)Phosphine tetrafluoroborate;(Di-t-butyl)phenylphosphine Tetrafluoroborate;i-tert-butylphenylphosphonium tetrafluoroborate;Phosphine, bis(1,1-dimethylethyl)phenyl-, tetrafluoroborate(1-) (1:1) (ACI);ditert-butyl(phenyl)phosphinotetrafluoroboronic acidsalt;DTBPP;Di-tert-butylphenylphosphine tetrafluoroborate | | CAS: | 612088-55-8 | | MF: | C14H24BF4P | | MW: | 310.12 | | EINECS: | | | Product Categories: | | | Mol File: | 612088-55-8.mol |  |
| | Di-tert-butylphenylphosphonium tetrafluoroborate Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H23P.BF4/c1-13(2,3)15(14(4,5)6)12-10-8-7-9-11-12;2-1(3,4)5/h7-11H,1-6H3;/q;-1/p+1 | | InChIKey | HRDPEVWZXUWEFR-UHFFFAOYSA-O | | SMILES | [B+3]([F-])([F-])([F-])[F-].P(C1C=CC=CC=1)(C(C)(C)C)C(C)(C)C.[H+] |
| TSCA | TSCA listed | | HS Code | 29310099 |
| | Di-tert-butylphenylphosphonium tetrafluoroborate Usage And Synthesis |
| Chemical Properties | White crystalline powder |
| | Di-tert-butylphenylphosphonium tetrafluoroborate Preparation Products And Raw materials |
|