|
|
| | Bis(tricyclohexylphosphine)palladium(II) Dichloride Basic information |
| | Bis(tricyclohexylphosphine)palladium(II) Dichloride Chemical Properties |
| Melting point | 270 °C (dec.)(lit.) | | density | 6.473 | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | Powder | | color | Yellow | | Water Solubility | Moderately soluble in dichloromethane and chloroform. Sparingly soluble in benzene and toluene. Insoluble in water, alcohols, acetone, diethyl ether, andhexanes. | | InChI | InChI=1S/2C18H33P.2ClH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*16-18H,1-15H2;2*1H;/q;;;;+2/p-2 | | InChIKey | KHXRPVIZRSHDNN-UHFFFAOYSA-N | | SMILES | P(C1CCCCC1)(C1CCCCC1)C1CCCCC1.P(C1CCCCC1)(C1CCCCC1)C1CCCCC1.[Pd](Cl)Cl | | CAS DataBase Reference | 29934-17-6 |
| | Bis(tricyclohexylphosphine)palladium(II) Dichloride Usage And Synthesis |
| Chemical Properties | Yellow powder | | Uses | suzuki reaction | | Uses | It is used as catalyst for C-C and C-N coupling reaction. It is used in the homogeneous carbonylation of chloroarenes under mild conditions. | | Uses | Application Guide for Palladium Catalyzed Cross-Coupling Reactions | | General Description | Dichlorobis(tricyclohexylphosphine)palladium(II) is widely employed as catalyst precursor in various carbon-carbon and carbon-heteroatom bond forming reactions. | | reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst | | Synthesis | Bis(tricyclohexylphosphine)palladium(II) Dichloride is prepared by reacting Tricyclohexyl phosphine with Palladium chloride refluxed in acetone for 3h. |
| | Bis(tricyclohexylphosphine)palladium(II) Dichloride Preparation Products And Raw materials |
|