|
|
| | 1-Chloroethyl cyclohexyl carbonate Basic information |
| | 1-Chloroethyl cyclohexyl carbonate Chemical Properties |
| Boiling point | 283.9±19.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | refractive index | 1.4540-1.4580 | | Fp | 84 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Ethyl Acetate, Methanol (Slightly) | | form | Oil | | color | Colourless | | Stability: | Hygroscopic | | InChI | InChI=1S/C9H15ClO3/c1-7(10)12-9(11)13-8-5-3-2-4-6-8/h7-8H,2-6H2,1H3 | | InChIKey | ONZWFHWHTYZZLM-UHFFFAOYSA-N | | SMILES | C(OC1CCCCC1)(=O)OC(Cl)C | | CAS DataBase Reference | 99464-83-2(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 1760 | | HS Code | 2915.90.5010 | | HazardClass | 8 | | PackingGroup | II |
| | 1-Chloroethyl cyclohexyl carbonate Usage And Synthesis |
| Chemical Properties | Colorless or pale yellow liquid | | Uses | 1-Chloroethyl Cyclohexyl Carbonate is a genotoxic impurity used in the synthesis of Candesartan Cilexetil. an angiotensin II receptor antagonist. | | Synthesis | 1-chloroethyl chloroformate (1.99 g, 1.5 mL, 13.9 mmol) was reacted with cyclohexanol (1.33 g, 1.4 mL, 13.3 mmol) and pyridine (1.27 g, 1.3 mL, 16.1 mmol) in methylene chloride (11 mL) at 78° C. for 3 h to give 1-chloroethyl cyclohexyl carbonate.
| | References | [1] Patent: US2008/125483, 2008, A1. Location in patent: Page/Page column 6-7
[2] Patent: WO2009/118580, 2009, A2. Location in patent: Page/Page column 17-18
[3] Patent: EP2526945, 2012, A1. Location in patent: Page/Page column 66
[4] Patent: WO2009/66917, 2009, A2. Location in patent: Page/Page column 17-18
[5] Patent: EP1477482, 2004, A1. Location in patent: Page 30 |
| | 1-Chloroethyl cyclohexyl carbonate Preparation Products And Raw materials |
|