|
|
| | N-DECANOPHENONE Basic information |
| Product Name: | N-DECANOPHENONE | | Synonyms: | Decanoylbenzene;Phenylnonyl ketone;n-Decanophenone,99%;Nonyl phenyl ketone >=99%;NONYL PHENYL KETONE;N-NONYL PHENYL KETONE;N-DECANOPHENONE;1-phenyl-1-decanon | | CAS: | 6048-82-4 | | MF: | C16H24O | | MW: | 232.36 | | EINECS: | 227-946-9 | | Product Categories: | | | Mol File: | 6048-82-4.mol |  |
| | N-DECANOPHENONE Chemical Properties |
| Melting point | 34-36 °C(lit.) | | Boiling point | 168 °C5 mm Hg(lit.) | | density | 0.9418 (rough estimate) | | refractive index | 1.4970 (estimate) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | form | powder to crystal | | color | White to Almost white | | BRN | 2048790 | | InChI | InChI=1S/C16H24O/c1-2-3-4-5-6-7-11-14-16(17)15-12-9-8-10-13-15/h8-10,12-13H,2-7,11,14H2,1H3 | | InChIKey | QQXJNLYVPPBERR-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)CCCCCCCCC | | CAS DataBase Reference | 6048-82-4(CAS DataBase Reference) | | EPA Substance Registry System | Decanophenone (6048-82-4) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29143900 | | Storage Class | 11 - Combustible Solids |
| | N-DECANOPHENONE Usage And Synthesis |
| Chemical Properties | CRYSTALLINE SOLID | | Uses | Decanophenone can be used as a thermochromic dry electrophotographic toner. | | Uses | HPLC standard | | General Description | Nonyl phenyl ketone (Decanophenone) serves as the best micelle marker to date. It has a strong chromophore which is detectable at all pH levels and is easy to dissolve in the mobile phase. |
| | N-DECANOPHENONE Preparation Products And Raw materials |
|