| Company Name: |
HASWELL Gold |
| Tel: |
13951186658 |
| Email: |
Haswellvip@gmail.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-Undecanophenone Basic information |
| Product Name: | N-Undecanophenone | | Synonyms: | DECYL PHENYL KETONE;1-Phenylundecane-1-one;Undecanophenone,98%;N-DECYL PHENYL KETONE;UNDECANOPHENONE;1-Phenyl-1-undecanone;1-Undecanone, 1-phenyl-;1-phenylundecanone | | CAS: | 4433-30-1 | | MF: | C17H26O | | MW: | 246.39 | | EINECS: | 224-633-9 | | Product Categories: | | | Mol File: | 4433-30-1.mol |  |
| | N-Undecanophenone Chemical Properties |
| Melting point | 28-30 °C | | Boiling point | 202-204°C 14mm | | density | 0.9384 (rough estimate) | | refractive index | 1.4830 (estimate) | | Fp | 202-204°C/14mm | | storage temp. | Sealed in dry,Room Temperature | | form | powder to lump to clear liquid | | color | White or Colorless to Almost white or Almost colorless | | BRN | 2211502 | | InChI | InChI=1S/C17H26O/c1-2-3-4-5-6-7-8-12-15-17(18)16-13-10-9-11-14-16/h9-11,13-14H,2-8,12,15H2,1H3 | | InChIKey | LHJBFOGCFZHBAJ-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)CCCCCCCCCC | | CAS DataBase Reference | 4433-30-1 |
| Safety Statements | 24/25 | | HS Code | 2914.39.9000 |
| | N-Undecanophenone Usage And Synthesis |
| Chemical Properties | white powder or crystalline low melting mass | | Synthesis Reference(s) | Tetrahedron Letters, 33, p. 4465, 1992 DOI: 10.1016/S0040-4039(00)60111-9 |
| | N-Undecanophenone Preparation Products And Raw materials |
|