|
|
| | beta-L-glucose pentaacetate Basic information |
| Product Name: | beta-L-glucose pentaacetate | | Synonyms: | beta-L-glucose pentaacetate;1,2,3,4,6-Penta-O-acetyl-β-L-glucopyranose;1,2,3,4,6-Penta-O-acetyl-b-L-glucopyranose;β-L-Glucopyranose, 1,2,3,4,6-pentaacetate;-β-L-Glucose Pentaacetate;β-L-Glucose Pentaacetate, CAS 66966-07-2;β-L-Glucose Pentaacetate;Penta?O?acetyl?β?L?glucopyranose | | CAS: | 66966-07-2 | | MF: | C16H22O11 | | MW: | 390.34 | | EINECS: | | | Product Categories: | Carbohydrates & Derivatives | | Mol File: | 66966-07-2.mol |  |
| | beta-L-glucose pentaacetate Chemical Properties |
| storage temp. | Refrigerator | | form | Solid | | color | White | | InChI | InChI=1/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12-,13-,14+,15-,16-/s3 | | InChIKey | LPTITAGPBXDDGR-JPNBUEAJNA-N | | SMILES | [C@H]1(OC(=O)C)[C@H](OC(=O)C)[C@H](O[C@@H](COC(=O)C)[C@@H]1OC(=O)C)OC(=O)C |&1:0,5,10,12,18,r| |
| | beta-L-glucose pentaacetate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Displays insulinotropic potential. |
| | beta-L-glucose pentaacetate Preparation Products And Raw materials |
|