| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Tetrabutylphosphonium iodide manufacturers
|
| | Tetrabutylphosphonium iodide Basic information |
| | Tetrabutylphosphonium iodide Chemical Properties |
| Melting point | 98-100℃ | | RTECS | TA2420000 | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | InChI | InChI=1S/C16H36P.HI/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 | | InChIKey | CCIYPTIBRAUPLQ-UHFFFAOYSA-M | | SMILES | [P+](CCCC)(CCCC)(CCCC)CCCC.[I-] | | CAS DataBase Reference | 3115-66-0(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | Tetrabutylphosphonium iodide Usage And Synthesis |
| Uses | Tetra-n-butylphosphonium iodide is used as phase transfer catalysts, antistatic agents, curing agents for epoxy resins, flame retardants, detergents. |
| | Tetrabutylphosphonium iodide Preparation Products And Raw materials |
|