- 5-AMinouracil
-
- $1.00
-
2020-05-15
- CAS: 932-52-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
- 5-Aminouracil
-
- $20.00
-
2019-07-06
- CAS:932-52-5
- Min. Order: 10KG
- Purity: 99%
- Supply Ability: 100kg
|
| | 5-Aminouracil Basic information | | Uses |
| Product Name: | 5-Aminouracil | | Synonyms: | 2,4-Dihydroxy-5-aminopyrimidine;3h)-pyrimidinedione,5-amino-4(1h;5-Amino-2,4(1H,3H)-pyrimidinedione;5-amino-uraci;Uracil, 5-amino-;5-AMINO-2,4-PYRIMIDINEDIOL;5-AMINO-2,4-DIHYDROXYPYRIMIDINE;5-AMINO-2,4-DIHYDROXYPYRIMIDINE[5-2,6] | | CAS: | 932-52-5 | | MF: | C4H5N3O2 | | MW: | 127.1 | | EINECS: | 213-252-3 | | Product Categories: | PYRIMIDINE;Miscellaneous;Nucleic acids | | Mol File: | 932-52-5.mol |  |
| | 5-Aminouracil Chemical Properties |
| Melting point | >300 °C (lit.) | | Boiling point | 235.85°C (rough estimate) | | density | 1.4748 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Fine Powder | | pka | 9.19±0.10(Predicted) | | color | Beige to brown | | Water Solubility | 0.5 g/L (20 ºC) | | BRN | 127250 | | InChI | InChI=1S/C4H5N3O2/c5-2-1-6-4(9)7-3(2)8/h1H,5H2,(H2,6,7,8,9) | | InChIKey | BISHACNKZIBDFM-UHFFFAOYSA-N | | SMILES | C1(=O)NC=C(N)C(=O)N1 | | CAS DataBase Reference | 932-52-5(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Aminouracil(932-52-5) | | EPA Substance Registry System | 5-Aminouracil (932-52-5) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-20/21/22 | | Safety Statements | 22-24/25-36-26 | | WGK Germany | 3 | | RTECS | YQ8740000 | | F | 10-23 | | TSCA | TSCA listed | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Toxicity | mmo-esc 300 mg/L JGMIAN 18,543,58 |
| | 5-Aminouracil Usage And Synthesis |
| Uses | 5-Aminouracil is a useful research chemical. | | Chemical Properties | beige to brown fine powder | | Safety Profile | Human mutation data reported.When heated to decomposition it emits toxic vapors ofNOx. | | Synthesis | The general procedure for the synthesis of 5-aminouracil from 5-nitropyrimidine-2,4(1H,3H)-dione is as follows:
1. to a 5 liter four-necked round-bottomed flask was added water (2.871 L), ammonia (116.1 mL) and 5-nitropyrimidine-2,4(1H,3H)-dione (180 g, 1.15 mol, 1.00 equiv.).
2. sodium conidiosulfite (Na2S2O2, 860 g, 6.06 mol, 4.30 eq.) was added in batches.
3. The pH of the reaction solution was adjusted to 8 using 25% ammonia.
4. The reaction mixture was stirred at 75 °C for 3 hours.
5. After completion of the reaction, the mixture was cooled to 15 °C using an ice/water bath.
6. The solid product was collected by filtration to afford 5-aminopyrimidine-2,4(1H,3H)-dione (118 g, 81% yield) as a yellow solid. | | References | [1] Patent: US2011/207713, 2011, A1. Location in patent: Page/Page column 58
[2] American Chemical Journal, 1905, vol. 33, p. 443
[3] Justus Liebigs Annalen der Chemie, 1899, vol. 309, p. 255,256
[4] Justus Liebigs Annalen der Chemie, 1889, vol. 251, p. 238
[5] Justus Liebigs Annalen der Chemie, 1885, vol. 229, p. 17 |
| | 5-Aminouracil Preparation Products And Raw materials |
|