| Company Name: |
SHANG FLUORO Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_1@163.com |
|
| | Sodium bromodifluoroacetate Basic information |
| Product Name: | Sodium bromodifluoroacetate | | Synonyms: | BROMODIFLUOROACETIC ACID SODIUM SALT;Sodium2-bromo-2,2-difluoroacetate;Bromo(difluoro)acetic acid, sodium salt, Sodium 2-bromo-2,2-difluoroethanoate;Bromodifluoroacetic acid sodium;Sodiumbromo(difluoro)acetate97%;Acetic acid,2-bromo-2,2-difluoro-, sodium salt (1:1);2-Bromo-2,2-difluoro-acetic Acid Sodium Salt (1:1);Sodium Bromodifluoroacetate > | | CAS: | 84349-27-9 | | MF: | C2BrF2NaO2 | | MW: | 196.91 | | EINECS: | | | Product Categories: | | | Mol File: | 84349-27-9.mol |  |
| | Sodium bromodifluoroacetate Chemical Properties |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | Water Solubility | Soluble in water | | form | powder to crystaline | | color | White to Almost white | | InChI | InChI=1S/C2HBrF2O2.Na/c3-2(4,5)1(6)7;/h(H,6,7);/q;+1/p-1 | | InChIKey | CAQKQIYWKXZJGD-UHFFFAOYSA-M | | SMILES | C(Br)(F)(F)C([O-])=O.[Na+] |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HazardClass | IRRITANT, HYGROSCOPIC | | HS Code | 2915907098 |
| | Sodium bromodifluoroacetate Usage And Synthesis |
| Uses | Generation of allylic CF3 moiety via decarboxylative coupling. Mild and atom-economical source of CF3. |
| | Sodium bromodifluoroacetate Preparation Products And Raw materials |
|