|
|
| | 3,5-Difluorochlorobenzene Basic information |
| Product Name: | 3,5-Difluorochlorobenzene | | Synonyms: | 3,5-DIFLUOROCHLOROBENZENE;1-Chloro-3,5-difluorobenzene 97%;1-Chloro-3,5-difluorobenzene97%;3,5-Difluorchlorbenzol;1-Chloro-3,5-difluorobenzene,95%;1-CHLORO-3,5-DIFLUOROBENZENE;3,5-Difluorochlorobenzene 97%;3,5-Difluorochlorobenzene 97%, 5-Difluorochlorobenzene 97% | | CAS: | 1435-43-4 | | MF: | C6H3ClF2 | | MW: | 148.54 | | EINECS: | 627-820-7 | | Product Categories: | Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Miscellaneous;Aryl;Halogenated Hydrocarbons;Trifluoromethoxybenzene Series;C6 | | Mol File: | 1435-43-4.mol |  |
| | 3,5-Difluorochlorobenzene Chemical Properties |
| Boiling point | 111-112 °C (lit.) | | density | 1.329 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.465(lit.) | | Fp | 85 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 2205670 | | InChI | InChI=1S/C6H3ClF2/c7-4-1-5(8)3-6(9)2-4/h1-3H | | InChIKey | RFKBODCWHNDUTJ-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC(F)=CC(F)=C1 | | CAS DataBase Reference | 1435-43-4(CAS DataBase Reference) |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 37/39-26-16 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 2 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29039990 |
| | 3,5-Difluorochlorobenzene Usage And Synthesis |
| Chemical Properties | clear colourless liquid | | Synthesis | General procedure for the synthesis of 3,5-difluorochlorobenzene from 6-chloro-2,4-difluoroaniline:
1. 0.5 moles (1.0 equiv.) of 6-chloro-2,4-difluoroaniline and 200 ml of dichloromethane were added to a reaction flask and stirred until completely dissolved.
2. 0.55 moles (1.1 eq.) of N-chlorosuccinimide (NCS) was added in 5 batches, the reaction temperature was controlled at 10~15°C, and after the addition was completed, the reaction was heated to reflux for 2 hours.
3. The completion of the reaction was monitored by TLC and the pH was adjusted to 6-7 by adding 10% dilute hydrochloric acid to the reaction mixture.
4. The organic phase was separated, washed with water and rotary evaporated to dryness to give 0.44 mol (0.88 eq.) of 2,4-difluoro-5-chloroaniline.
5. 0.44 mol of 2,4-difluoro-5-chloroaniline was added to 1.5 mol (3 eq.) of 25% dilute sulfuric acid and stirred for 0.5 hr.
6. Add 0.75 mol (1.5 eq.) of sodium phosphite, control the reaction temperature at 30~35°C, slowly add 0.5 mol (1 eq.) of aqueous sodium nitrite dropwise, control the rate of dropwise acceleration so that the reaction temperature rises 4~5°C per hour.
7. Warm up to 60°C, keep the temperature stirring for 2 hours. 8.
8. leave to stratify, the organic phase is washed with water and then steam distilled. 9.
9. 0.41 moles (0.82 equivalents) of 3,5-difluorochlorobenzene were obtained by distillation, with a purity of 99.8%. | | References | [1] Patent: CN106986741, 2017, A. Location in patent: Paragraph 0017; 0018; 0019; 0020; 0021; 0022 |
| | 3,5-Difluorochlorobenzene Preparation Products And Raw materials |
| Raw materials | 1,3-Dimethyl-2-imidazolidinone-->2,4-Difluoroacetanilide-->2,4-DIFLUORO-6-NITROANILINE-->2-CHLORO-4,6-DIFLUOROANILINE-->Sodium nitrite-->1,3-Diethylbenzene-->3,5-Difluoronitrobenzene-->1,3,5-Trichlorobenzene | | Preparation Products | 3-CHLORO-5-FLUOROPHENYLACETIC ACID-->1,3,5-Trifluorobenzene |
|