|
|
| | Olanzapine ThiolactaM IMpurity Basic information |
| | Olanzapine ThiolactaM IMpurity Chemical Properties |
| Melting point | 167-168°C (dec.) | | Boiling point | 476.9±55.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | Solid | | pka | 9.49±0.40(Predicted) | | color | Light Yellow to Dark Yellow | | Stability: | Hygroscopic | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C17H20N4OS/c1-12(22)11-13-16(21-9-7-20(2)8-10-21)18-14-5-3-4-6-15(14)19-17(13)23/h3-6,11H,7-10H2,1-2H3,(H,19,23)/b13-11- | | InChIKey | UZXKASHICBLMCC-QBFSEMIESA-N | | SMILES | C(=C1/C(=S)NC2=CC=CC=C2N=C/1N1CCN(C)CC1)/C(=O)C |
| WGK Germany | WGK 3 | | HS Code | 29339900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Skin Sens. 1 |
| | Olanzapine ThiolactaM IMpurity Usage And Synthesis |
| Chemical Properties | Brownish Yellow Solid | | Uses | A degradation product of Olanzapine (LY170053) (O253750) in solid oral formulations. |
| | Olanzapine ThiolactaM IMpurity Preparation Products And Raw materials |
|