Olanzapine ThioacetoxyMethylidene IMpurity
Discontinued manufacturers
- Olanzapine impurity Q
-
-
2025-12-16
- CAS:1320360-87-9
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 100000000
|
| | Olanzapine ThioacetoxyMethylidene IMpurity
Discontinued Basic information |
| | Olanzapine ThioacetoxyMethylidene IMpurity
Discontinued Chemical Properties |
| Boiling point | 449.9±55.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | pka | 9.68±0.40(Predicted) | | InChI | InChI=1S/C17H20N4O2S/c1-12(22)23-11-13-16(21-9-7-20(2)8-10-21)18-14-5-3-4-6-15(14)19-17(13)24/h3-6,11H,7-10H2,1-2H3,(H,19,24)/b13-11- | | InChIKey | KMCOFWWWTNQXFV-QBFSEMIESA-N | | SMILES | N1C2=CC=CC=C2N=C(N2CCN(C)CC2)/C(=C/OC(C)=O)/C1=S |
| | Olanzapine ThioacetoxyMethylidene IMpurity
Discontinued Usage And Synthesis |
| Uses | A degradation product of Olanzapine (LY170053) (O253750) in solid oral formulations. Olanzapine impurity. |
| | Olanzapine ThioacetoxyMethylidene IMpurity
Discontinued Preparation Products And Raw materials |
|