HydroxyMethylidene thione manufacturers
|
| | HydroxyMethylidene thione Basic information |
| Product Name: | HydroxyMethylidene thione | | Synonyms: | Olanzapine ThiohydroxyMethylidene (HydroxyMethylidene Thione);Olanzapine Impurity 5 (Olanzapine Hydroxymethylidene);AHLVAHJPLRKOQZ-KHPPLWFESA-N;Olanzapine Impurity 18;HydroxyMethylidene thione;Olanzapine Impurity 9;Olanzapine Hydroxymethylidene;2H-1,5-Benzodiazepine-2-thione, 1,3-dihydro-3-(hydroxymethylene)-4-(4-methyl-1-piperazinyl)- | | CAS: | 1320360-86-8 | | MF: | C15H18N4OS | | MW: | 302.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1320360-86-8.mol |  |
| | HydroxyMethylidene thione Chemical Properties |
| Boiling point | 439.4±55.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | pka | 4.35±0.40(Predicted) | | InChI | InChI=1S/C15H18N4OS/c1-18-6-8-19(9-7-18)14-11(10-20)15(21)17-13-5-3-2-4-12(13)16-14/h2-5,10,20H,6-9H2,1H3,(H,17,21) | | InChIKey | AHLVAHJPLRKOQZ-UHFFFAOYSA-N | | SMILES | N1C2=CC=CC=C2N=C(N2CCN(C)CC2)C(=CO)C1=S |
| | HydroxyMethylidene thione Usage And Synthesis |
| Uses | A degradation product of Olanzapine (LY170053) (O253750) in solid oral formulations. Olanzapine impurity. |
| | HydroxyMethylidene thione Preparation Products And Raw materials |
|