(R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diol, >=95% manufacturers
|
| | (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diol, >=95% Basic information |
| Product Name: | (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diol, >=95% | | Synonyms: | (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diol, 99%e.e.;(Ra)-1,1'-spirobiindane-7,7'-diol;R-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diol;R-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-7,7'-diol;(1R)-2,2',3,3'-tetrahydro-1,1'-Spirobi[1H-indene]-7,7'-diol;1,1'-Spirobi[1H-indene]-7,7'-diol, 2,2',3,3'-tetrahydro-, (1R)-;(R)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[INDENE]-7,7'-DIOL,99%;SF120083 | | CAS: | 223259-62-9 | | MF: | C17H16O2 | | MW: | 252.31 | | EINECS: | | | Product Categories: | BINOL Series;Chiral Oxygen;Chiral Spiro Ligand | | Mol File: | 223259-62-9.mol | ![(R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diol, >=95% Structure](CAS/20150408/GIF/223259-62-9.gif) |
| | (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diol, >=95% Chemical Properties |
| Melting point | 156.0 to 160.0 °C | | Boiling point | 433.0±45.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 9.70±0.20(Predicted) | | color | white | | InChI | InChI=1S/C17H16O2/c18-13-5-1-3-11-7-9-17(15(11)13)10-8-12-4-2-6-14(19)16(12)17/h1-6,18-19H,7-10H2 | | InChIKey | YBRDFCQKQVTQKX-UHFFFAOYSA-N | | SMILES | [C@@]12(C3=C(C=CC=C3O)CC1)C1=C(C=CC=C1O)CC2 |
| | (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diol, >=95% Usage And Synthesis |
| Uses | (R)-SPINOL is used in the synthesis of (R,R)-f-SpiroPhos (S683030). |
| | (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diol, >=95% Preparation Products And Raw materials |
|