1,1'-SPIROBIINDANE-7,7'-DIOL manufacturers
|
| | 1,1'-SPIROBIINDANE-7,7'-DIOL Basic information |
| Product Name: | 1,1'-SPIROBIINDANE-7,7'-DIOL | | Synonyms: | 1,1'-SPIROBIINDANE-7,7'-DIOL;(1S)-2,2',3,3'-tetrahydro-1,1'-Spirobi[1H-indene]-7,7'-diol;(S)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[INDENE]-7,7'-DIOL, >=95%;S-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diol;S-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-7,7'-diol; 1,1'-Spirobi[1H-indene]-7,7'-diol,2,2',3,3'-tetrahydro-;1,1'-Spirobi[1H-indene]-7,7'-diol, 2,2',3,3'-tetrahydro-, (1S)-;S-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-di | | CAS: | 223259-63-0 | | MF: | C17H16O2 | | MW: | 252.31 | | EINECS: | | | Product Categories: | BINOL Series;Chiral Oxygen;Chiral Spiro Ligand | | Mol File: | 223259-63-0.mol |  |
| | 1,1'-SPIROBIINDANE-7,7'-DIOL Chemical Properties |
| Melting point | 155-156℃ | | Boiling point | 433.0±45.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 9.70±0.20(Predicted) | | form | powder to crystaline | | color | White to Orange to Green | | InChI | InChI=1S/C17H16O2/c18-13-5-1-3-11-7-9-17(15(11)13)10-8-12-4-2-6-14(19)16(12)17/h1-6,18-19H,7-10H2 | | InChIKey | YBRDFCQKQVTQKX-UHFFFAOYSA-N | | SMILES | [C@]12(C3=C(C=CC=C3O)CC1)C1=C(C=CC=C1O)CC2 |
| | 1,1'-SPIROBIINDANE-7,7'-DIOL Usage And Synthesis |
| Uses | (S)-SPINOL is used to synthesis a new class of chiral phosphoric acids with spirobiindane as scaffold and employed to catalyze the asymmetric FriedelCrafts reaction of indoles with imines to afford 3-indolyl methanamines. |
| | 1,1'-SPIROBIINDANE-7,7'-DIOL Preparation Products And Raw materials |
|