| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Aniline (13C6) Basic information |
| | Aniline (13C6) Chemical Properties |
| Melting point | -6 °C (lit.) | | Boiling point | 184 °C (lit.) | | density | 1.087 g/mL at 25 °C | | refractive index | n20/D 1.586(lit.) | | Fp | 158 °F | | storage temp. | 2-8°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH 7.2) (1:4): 0.2 mg/ml | | form | A neat oil | | Stability: | Air sensitive, Material Darkens In Storage With No Loss In Purity, Material dark | | InChI | 1S/C6H7N/c7-6-4-2-1-3-5-6/h1-5H,7H2/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | PAYRUJLWNCNPSJ-IDEBNGHGSA-N | | SMILES | N[13c]1[13cH][13cH][13cH][13cH][13cH]1 | | CAS Number Unlabeled | 62-53-3 |
| | Aniline (13C6) Usage And Synthesis |
| Uses | Isotope labelled Aniline (A662475), which is used in the manufacture of dyes, medicinals, resins, varnishes, perfumes, as a vulcanizing rubber or even as a solvent (1,2). Hazardous and noxious substance which affects the early life stages of marine animals (3). Drinking water contaminant candidate list 3 (CCL 3) compound as per United States Environmental Protection Agency (EPA), environmental, and food contaminants. |
| | Aniline (13C6) Preparation Products And Raw materials |
|