| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
PHENOL (13C6) manufacturers
- Phenol-13C6
-
- $37.00
-
2026-05-11
- CAS:89059-34-7
- Purity: 99.89%
- Supply Ability: 10g
|
| | PHENOL (13C6) Basic information |
| | PHENOL (13C6) Chemical Properties |
| Melting point | 40-42 °C (lit.) | | Boiling point | 182 °C (lit.) | | density | 1.139 g/mL at 25 °C | | Fp | 79 °C | | storage temp. | Store at -20°C | | solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,Ethanol: 30 mg/ml,Ethanol:PBS (pH 7.2) (1:4): 0.2 mg/ml | | form | A crystalline solid | | Stability: | Hygroscopic, Light Sensitive | | InChI | 1S/C6H6O/c7-6-4-2-1-3-5-6/h1-5,7H/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | ISWSIDIOOBJBQZ-IDEBNGHGSA-N | | SMILES | O[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 | | CAS Number Unlabeled | 108-95-2 |
| Hazard Codes | T,C | | Risk Statements | 23/24/25-34-48/20/21/22-68 | | Safety Statements | 24/25-26-28-36/37/39-45 | | RIDADR | UN 1671 6.1/PG 2 | | WGK Germany | 2 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 2
Eye Dam. 1
Muta. 2
Skin Corr. 1B
STOT RE 2 |
| | PHENOL (13C6) Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 13C-labelled Phenol (P318000). |
| | PHENOL (13C6) Preparation Products And Raw materials |
|