| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-n-Pentylpropane-1,3-diol Basic information |
| Product Name: | 2-n-Pentylpropane-1,3-diol | | Synonyms: | 2-PENTYL-1,3-PROPANEDIOL;2-N-AMYLPROPANE-1,3-DIOL;1,1-BIS(HYDROXYMETHYL)HEXANE;2-pentyl-3-propanediol;2-Pentylpropane-1,3-diol;dimethyl-phenyl-[2-(1-piperidinyl)ethyl]silane;1,3-Propanediol, 2-pentyl-;2-n-Pentylpropane-1,3-diol | | CAS: | 25462-23-1 | | MF: | C8H18O2 | | MW: | 146.23 | | EINECS: | | | Product Categories: | Propanes/propenes | | Mol File: | 25462-23-1.mol |  |
| | 2-n-Pentylpropane-1,3-diol Chemical Properties |
| Boiling point | 100-106 °C(Press: 0.2 Torr) | | density | 0.937±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.55±0.10(Predicted) | | InChI | InChI=1S/C8H18O2/c1-2-3-4-5-8(6-9)7-10/h8-10H,2-7H2,1H3 | | InChIKey | RHYUFGNCUXTFTC-UHFFFAOYSA-N | | SMILES | C(O)C(CCCCC)CO |
| Provider | Language |
|
ALFA
| English |
| | 2-n-Pentylpropane-1,3-diol Usage And Synthesis |
| | 2-n-Pentylpropane-1,3-diol Preparation Products And Raw materials |
|