|
|
| | H-Pro-Phe-OH Basic information |
| Product Name: | H-Pro-Phe-OH | | Synonyms: | pro-phecrystalline;L-Pro-L-Phe-OH;N-L-Prolyl-L-phenylalanine;Pro-Phe-OH;PROLINE-PHENYLALANINE;L-Phenylalanine, L-prolyl-;Prolylphenylalanine;(S)-3-Phenyl-2-(((S)-pyrrolidin-2-yl)formamido)propanoic acid | | CAS: | 13589-02-1 | | MF: | C14H18N2O3 | | MW: | 262.3 | | EINECS: | | | Product Categories: | | | Mol File: | 13589-02-1.mol |  |
| | H-Pro-Phe-OH Chemical Properties |
| Melting point | 250-251 °C | | Boiling point | 531.9±50.0 °C(Predicted) | | density | 1.228±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | solubility | Aqueous Acid (slightly) | | form | Solid | | pka | 3.40±0.10(Predicted) | | color | White to Off-White | | InChI | 1S/C14H18N2O3/c17-13(11-7-4-8-15-11)16-12(14(18)19)9-10-5-2-1-3-6-10/h1-3,5-6,11-12,15H,4,7-9H2,(H,16,17)(H,18,19) | | InChIKey | IWIANZLCJVYEFX-UHFFFAOYSA-N | | SMILES | OC(=O)C(Cc1ccccc1)NC(=O)C2CCCN2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | H-Pro-Phe-OH Usage And Synthesis |
| Uses | Prolylphenylalanine can be used in biochemical and metabolomics research applications | | Definition | ChEBI: Pro-Phe is a dipeptide formed from L-proline and L-phenylalanine residues. It has a role as a metabolite. |
| | H-Pro-Phe-OH Preparation Products And Raw materials |
|