METHYL 2-METHOXYPROPIONATE manufacturers
|
| | METHYL 2-METHOXYPROPIONATE Basic information | | Uses |
| Product Name: | METHYL 2-METHOXYPROPIONATE | | Synonyms: | (R,S)-2-Methoxy-propionicacidmethylester;2-methoxy-propanoicacimethylester;Methyl2-methoxypropanoate;Propanoicacid,2-methoxy-,methylester;R,S-2-Methoxy-propionicacidmethylester;METHYL 2-METHOXYPROPIONATE;2-Methoxypropanoic acid methyl ester;Methyl-2-methoxypropionat | | CAS: | 17639-76-8 | | MF: | C5H10O3 | | MW: | 118.13 | | EINECS: | 241-622-4 | | Product Categories: | | | Mol File: | 17639-76-8.mol |  |
| | METHYL 2-METHOXYPROPIONATE Chemical Properties |
| Boiling point | 43-44°C | | density | 1.0108 g/cm3 | | refractive index | 1.3970 | | Fp | 36°C | | Water Solubility | Soluble in water. | | BRN | 1720819 | | InChI | InChI=1S/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3 | | InChIKey | VABBJJOSOCPYIT-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(OC)C | | LogP | 0.360 (est) | | EPA Substance Registry System | Methyl 2-methoxypropionate (17639-76-8) |
| Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | 3272 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III |
| Provider | Language |
|
ALFA
| English |
| | METHYL 2-METHOXYPROPIONATE Usage And Synthesis |
| Uses | Methyl 2-Methoxypropionate is used as a reagent in the synthesis of 2-methoxy-2-methyl-3-{6-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]pyridin-3-yl}propanoic acid which is a dual PPARα/γ agonist. | | Uses | Methyl 2-methoxypropionate, is used as a pharmaceutical intermediate. | | Synthesis | Methyl 2-methoxypropionate is prepared by esterification of the known O-methyllactic acid. |
| | METHYL 2-METHOXYPROPIONATE Preparation Products And Raw materials |
|