| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
PHOTOBIOTIN ACETATE manufacturers
|
| | PHOTOBIOTIN ACETATE Basic information |
| Product Name: | PHOTOBIOTIN ACETATE | | Synonyms: | PHOTOBIOTIN ACETATE;N-(4-AZIDO-2-NITROPHENYL)-N'-(3-BIOTINYLAMINOPROPYL)-N'-METHYL-1,3-PROPANEDIAMINE ACETATE;N-(4-Azido-2-nitrophenyl)-Nμ-(3-biotinylaminopropyl)-Nμ-methyl-1,3-propanediamine acetate salt, Biotin {3-[3-(4-azido-2-nitroanilino)-N-methylpropylamino]propylamide} acetate salt;Synonym Biotin {3-[3;N-(3-((3-((4-azido-2-nitrophenyl)aMino)propyl)(Methyl)aMino)propyl)-5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]iMidazol-4-yl)pentanaMide acetate;BIOTIN [3-[3-(4-AZIDO-2-NITROANILINO)-N-METHYLPROPYLAMINO]PROPYLAMIDE] ACETATE | | CAS: | 96087-38-6 | | MF: | C25H39N9O6S | | MW: | 593.7 | | EINECS: | | | Product Categories: | biotinyl | | Mol File: | 96087-38-6.mol |  |
| | PHOTOBIOTIN ACETATE Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: 10 mg/mL Stable for at least 5 months if kept frozen and protected from light. | | form | powder | | color | orange to red | | Water Solubility | H2O: 10mg/mL (Stable for at least 5months if kept frozen and protected from light.) | | InChIKey | FFBLNTOMOSLSQM-AYEYRVMASA-N | | SMILES | CC(O)=O.CN(CCCNC(=O)CCCC[C@@H]1SCC2NC(=O)NC12)CCCNc3ccc(cc3[N+]([O-])=O)N=[N+]=[N-] |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-8-10 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | PHOTOBIOTIN ACETATE Usage And Synthesis |
| Uses | Photobiotin acetate salt is a photo-activatable biotin analogue. It can be used in biological study and use for protein patterning with a photoactivatable derivative of biotin. | | General Description | Photobiotin acetate is made up of biotin, which is bound with the help of a charged linker arm to a photoreactive arylazide group. | | Biochem/physiol Actions | Photobiotin is a photo-activatable analog of biotin used primarily for labeling DNA, RNA and proteins. Probes prepared using photobiotin can detect target DNA as little as 0.5 pg. |
| | PHOTOBIOTIN ACETATE Preparation Products And Raw materials |
|