|
|
| | LACMOID Basic information |
| | LACMOID Chemical Properties |
| Melting point | >250°C | | Boiling point | 785.7±60.0 °C(Predicted) | | density | 1.58±0.1 g/cm3(Predicted) | | storage temp. | room temp | | solubility | Sparingly soluble in water, ether; soluble in water, ethanol, methanol, amyl alcohol, Hacetone, acetic acid; practically insoluble in chloroform, benzene, petroleum ether | | pka | 5.31(at 25℃) | | form | powder | | color | Black-violet | | PH Range | Red (4.4) to blue (6.4) | | Water Solubility | Slightly soluble in water | | λmax | 611nm | | Major Application | Electrochromic devices, photosensitive materials, parasiticides, hair dyes, cosmetics, ointment for hemorrhoids | | InChI | 1S/C24H16N2O6/c25-17-9-23-18(7-15(17)13-3-1-11(27)5-20(13)29)26-19-8-16(22(31)10-24(19)32-23)14-4-2-12(28)6-21(14)30/h1-10,27-30H,25H2 | | InChIKey | ABNVFGQXCGFSFH-UHFFFAOYSA-N | | SMILES | Nc1cc2OC3=CC(=O)C(=CC3=Nc2cc1-c4ccc(O)cc4O)c5ccc(O)cc5O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | LACMOID Usage And Synthesis |
| Uses | Lacmoid is a stain/dye. Dyes and metabolites. |
| | LACMOID Preparation Products And Raw materials |
|