2,3,6-TRIFLUOROPYRIDINE manufacturers
|
| | 2,3,6-TRIFLUOROPYRIDINE Basic information |
| Product Name: | 2,3,6-TRIFLUOROPYRIDINE | | Synonyms: | 2,3,6-TRIFLUOROPYRIDINE;2,3,6-Trifluoropyridine, 98+%;CL016;2,3,6-TRIBROMO-P-CRESOL;Pyridine, 2,3,6-trifluoro-;2,3,6-TRIFLUOROPYRIDINE ISO 9001：2015 REACH | | CAS: | 3512-18-3 | | MF: | C5H2F3N | | MW: | 133.07 | | EINECS: | 680-721-0 | | Product Categories: | Pyridine | | Mol File: | 3512-18-3.mol |  |
| | 2,3,6-TRIFLUOROPYRIDINE Chemical Properties |
| Melting point | 115-116 °C | | Boiling point | 100-102°C | | density | 1,499 g/cm3 | | refractive index | 1.42 | | Fp | 30°C | | storage temp. | 2-8°C | | pka | -8.51±0.10(Predicted) | | form | liquid | | color | Clear, red | | Specific Gravity | 1.499 | | Water Solubility | Not miscible or difficult to mix in water. | | BRN | 1365146 | | InChI | InChI=1S/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H | | InChIKey | HRLIANGJWPJFKW-UHFFFAOYSA-N | | SMILES | C1(F)=NC(F)=CC=C1F | | CAS DataBase Reference | 3512-18-3(CAS DataBase Reference) |
| Hazard Codes | Xi,F,C | | Risk Statements | 36/37/38-10 | | Safety Statements | 26-36/37/39-37 | | RIDADR | 1993 | | Hazard Note | Flammable/Irritant | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2933399990 |
| Provider | Language |
|
ALFA
| English |
| | 2,3,6-TRIFLUOROPYRIDINE Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 2,3,6-Trifluoropyridine is used as an intermediate in organic syntheses and in pharmaceuticals. | | Synthesis | 2,3,6-Trifluoropyridine can be obtained from 2,3,5,6-tetrafluoropyridine by removing one fluorine. It has been reported in the literature that 2,3,6-trifluoropyridine can be used to prepare small molecule inhibitors of MALT1. |
| | 2,3,6-TRIFLUOROPYRIDINE Preparation Products And Raw materials |
|