| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Chloro-2,4,5-trifluorobenzoic acid Basic information |
| Product Name: | 3-Chloro-2,4,5-trifluorobenzoic acid | | Synonyms: | 3-CHLORO-2,4,5-TRIFLUOROBENZOIC ACID;TIMTEC-BB SBB003448;2,4,5-TRIFLUORO-3-CHLOROBENZOIC ACID;3-Chloro-2,4,5-trifluorobenzoic acid,98%;3-Carboxy-2,5,6-trifluorochlorobenzene;Sitafloxacin Impurity 40;3-Chloro-2,4,5-Trilfuorobenzoic acid;2,4,5-trifluoro-3-chlorobenzoic acid and derivatives | | CAS: | 101513-77-3 | | MF: | C7H2ClF3O2 | | MW: | 210.54 | | EINECS: | 630-223-4 | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;C7;Carbonyl Compounds;Carboxylic Acids;Benzoic acid;Heterocyclic Compounds | | Mol File: | 101513-77-3.mol |  |
| | 3-Chloro-2,4,5-trifluorobenzoic acid Chemical Properties |
| Melting point | 112-116 °C (lit.) | | Boiling point | 272℃ | | density | 1.663±0.06 g/cm3(Predicted) | | Fp | 118°(244°F) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 2.50±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C7H2ClF3O2/c8-4-5(10)2(7(12)13)1-3(9)6(4)11/h1H,(H,12,13) | | InChIKey | KBESHLYCSZINAJ-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(F)c(F)c(Cl)c1F | | CAS DataBase Reference | 101513-77-3(CAS DataBase Reference) |
| | 3-Chloro-2,4,5-trifluorobenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow powder | | Uses | 3-Chloro-2,4,5-trifluorobenzoic Acid is a useful synthetic intermediate. It can be used to synthesize 3-hydroxyquinazoline-2,4-diones as antibacterial agents. |
| | 3-Chloro-2,4,5-trifluorobenzoic acid Preparation Products And Raw materials |
|