|
|
| | 6-DEOXY-L-GALACTOPYRANOSE Basic information |
| Product Name: | 6-DEOXY-L-GALACTOPYRANOSE | | Synonyms: | 6-DEOXY-L-GALACTOPYRANOSE;6-DEOXY-L-GALACTOSE;6-DEOXY-ALPHA-L-GALACTOSE;3,4,5-TRIS-BENZYLOXY-2-METHYL-6-P-TOLYLSULFANYL-TETRAHYDRO-PYRAN;L-FUC;L-(-)-FUCOSE;(3S,4R,5S,6S)-6-Methyltetrahydro-2H-pyran-2,3,4,5-tetraol;6-Deoxy-a-L-galactopyranose | | CAS: | 6696-41-9 | | MF: | C6H12O5 | | MW: | 164.16 | | EINECS: | 219-452-7 | | Product Categories: | | | Mol File: | 6696-41-9.mol |  |
| | 6-DEOXY-L-GALACTOPYRANOSE Chemical Properties |
| Melting point | 136-140°C | | Boiling point | 323.9±42.0 °C(Predicted) | | density | 1.556±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.28±0.70(Predicted) | | Appearance | White to off-white Solid | | Sensitive | Hygroscopic | | Merck | 14,4279 | | BRN | 1422661 | | InChI | InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3+,4+,5-,6+/m0/s1 | | InChIKey | SHZGCJCMOBCMKK-SXUWKVJYSA-N | | SMILES | O[C@@H]1[C@@H](O[C@H]([C@H]([C@@H]1O)O)O)C |
| Provider | Language |
|
ALFA
| English |
| | 6-DEOXY-L-GALACTOPYRANOSE Usage And Synthesis |
| Definition | ChEBI: An L-fucopyranose having alpha-configuration at the anomeric centre. |
| | 6-DEOXY-L-GALACTOPYRANOSE Preparation Products And Raw materials |
|