| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Nitrophenyl-alpha-L-fucopyranoside Basic information |
| | 4-Nitrophenyl-alpha-L-fucopyranoside Chemical Properties |
| Melting point | 192-194°C | | Boiling point | 515.4±50.0 °C(Predicted) | | density | 1.503±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | acetone: 4 mg/mL, clear | | pka | 12.68±0.70(Predicted) | | form | Solid | | color | White to Off-White | | BRN | 89535 | | InChI | InChI=1/C12H15NO7/c1-6-9(14)10(15)11(16)12(19-6)20-8-4-2-7(3-5-8)13(17)18/h2-6,9-12,14-16H,1H3/t6-,9+,10+,11-,12-/s3 | | InChIKey | YILIDCGSXCGACV-SQKFTNEHSA-N | | SMILES | [C@H]1(O[C@H]([C@@H](O)[C@@H](O)[C@@H]1O)C)OC1=CC=C([N+]([O-])=O)C=C1 |&1:0,2,3,5,7,r| | | CAS DataBase Reference | 10231-84-2(CAS DataBase Reference) |
| WGK Germany | 3 | | F | 10-21 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | 4-Nitrophenyl-alpha-L-fucopyranoside Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | p-Nitrophenyl α-L-Fucopyranoside (cas# 10231-84-2) is a compound useful in organic synthesis. | | Definition | ChEBI: An alpha-L-fucoside that is alpha-L-fucopyranose in which the anomeric hydroxy hydrogen is replaced by a 4-nitrophenyl group. | | Biological Activity | 4-Nitrophenyl α-L-fucopyranoside is a chromogenic substrate th at is used in kinetic studies of α-fucosidases. |
| | 4-Nitrophenyl-alpha-L-fucopyranoside Preparation Products And Raw materials |
|