- FMOC-N(HMB)-GLY-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:148515-78-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | FMOC-N(HMB)-GLY-OH Basic information |
| Product Name: | FMOC-N(HMB)-GLY-OH | | Synonyms: | 2-({[(9H-fluoren-9-yl)methoxy]carbonyl}[(2-hydroxy-4-methoxyphenyl)methyl]amino)acetic acid;N-Fmoc-N-(2-hydroxy-4-methoxybenzyl)glycine;N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-(2-hydroxy-4-methoxybenzyl)glycine;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-N-(2-HYDROXY-4-METHOXY-BENZYL)-GLYCINE;N-ALPHA-FMOC-N-ALPHA-(2-HYDROXY-4-METHOXYBENZYL)GLYCINE;FMOC-N(HMB)-GLY-OH;FMOC-(HMB)GLY-OH;Fmoc-N-(2-hydroxy-4-methoxy-Bzl)-Gly-OH | | CAS: | 148515-78-0 | | MF: | C25H23NO6 | | MW: | 433.45 | | EINECS: | | | Product Categories: | | | Mol File: | 148515-78-0.mol |  |
| | FMOC-N(HMB)-GLY-OH Chemical Properties |
| Boiling point | 679.4±55.0 °C(Predicted) | | density | 1.338±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.81±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C25H23NO6/c1-31-17-11-10-16(23(27)12-17)13-26(14-24(28)29)25(30)32-15-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-12,22,27H,13-15H2,1H3,(H,28,29) | | InChIKey | SFNQJVQTVYXPFN-UHFFFAOYSA-N | | SMILES | C(O)(=O)CN(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)CC1=CC=C(OC)C=C1O |
| | FMOC-N(HMB)-GLY-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-(2-hydroxy-4-methoxybenzyl)glycine is a Glycine.html" class="link-product" target="_blank">Glycine (HY-Y0966) derivative[1]. | | Definition | Fmoc-N(HMB)-Gly-OH serves as a building block in the synthesis of peptides. The Fmoc group acts as a protective group, allowing for selective deprotection and subsequent coupling reactions during solid-phase peptide synthesis. Fmoc is often preferred over Boc because of its ease of cleavage. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | FMOC-N(HMB)-GLY-OH Preparation Products And Raw materials |
|