|
|
| | Bis[alpha,alpha-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur Basic information |
| Product Name: | Bis[alpha,alpha-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur | | Synonyms: | Bis[a,a-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur;Bis[α,α-bis(trifluoromethyl)b;Martin Sulfurane Dehydrating agent technical grade;Sulfur, bis[a,a-bis(trifluoromethyl)benzenemethanolato-kO]diphenyl-, (T-4)-;-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur;Bis[αMARTIN SULFURANE DEHYDRATING AGENT;BIS[ALPHA,ALPHA-BIS(TRIFLUOROMETHYL)BENZENEMETHANOLATO]DIPHENYLSULFUR | | CAS: | 32133-82-7 | | MF: | C30H20F12O2S | | MW: | 672.52 | | EINECS: | | | Product Categories: | | | Mol File: | 32133-82-7.mol | ![Bis[alpha,alpha-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur Structure](CAS/GIF/32133-82-7.gif) |
| | Bis[alpha,alpha-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur Chemical Properties |
| Melting point | 106-108 °C(lit.) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | Freezer | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Orange to Green | | BRN | 1416879 | | Stability: | Extremely Moisture Sensitive | | InChIKey | RMIBJVUYNZSLSD-UHFFFAOYSA-N | | SMILES | S(C1=CC=CC=C1)(C1=CC=CC=C1)(OC(C(F)(F)F)(C(F)(F)F)C1=CC=CC=C1)OC(C(F)(F)F)(C(F)(F)F)C1=CC=CC=C1 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 3 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29309090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Bis[alpha,alpha-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur Usage And Synthesis |
| Chemical Properties | IUPAC Name: [2-({diphenyl[(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)oxy]-λ-sulfanyl}oxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene | | Uses | Versatile dehydrating and oxidizing agent. For chemistry and references, see Aldrichimica Acta . | | Preparation | Bis[alpha,alpha-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur can be prepared by the reaction of the potassium salt of 1,1,1,3,3,3-hexafluoro-2-phenylisopropanol with diphenyl sulfide in the presence of chlorine in ether at -78 °C. | | storage | avoid moisture; readily hydrolyzed; stable at rt; decomposes slowly at rt in solution. |
| | Bis[alpha,alpha-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur Preparation Products And Raw materials |
|