| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
(2E)-TCO-PNB ester manufacturers
- (2E)-TCO-PNB ester
-
-
2025-06-07
- CAS:1580501-97-8
- Min. Order: 10mg
- Purity: >95.00%
- Supply Ability: 10mg
|
| | (2E)-TCO-PNB ester Basic information |
| Product Name: | (2E)-TCO-PNB ester | | Synonyms: | (2E)-TCO-PNB ester;TCO*A - active ester (p-NPE);TCO*A - active ester (p-NPC);Carbonic acid, (2E)-2-cycloocten-1-yl 4-nitrophenyl ester;rel-(1R-2E-pS)-axial-Cyclooct-2-en-1-yl (4-nitrophenyl) carbonate;2-Cyclooctenyl (E)-(4-Nitrophenyl) Carbonate;rTCO-PNP carbonate;(E)-Cyclooct-2-en-1-yl (4-nitrophenyl) carbonate | | CAS: | 1580501-97-8 | | MF: | C15H17NO5 | | MW: | 291.3 | | EINECS: | | | Product Categories: | SiChem | | Mol File: | 1580501-97-8.mol |  |
| | (2E)-TCO-PNB ester Chemical Properties |
| Boiling point | 433.9±45.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | Solid | | InChI | InChI=1S/C15H17NO5/c17-15(20-13-6-4-2-1-3-5-7-13)21-14-10-8-12(9-11-14)16(18)19/h4,6,8-11,13H,1-3,5,7H2/b6-4+ | | InChIKey | XNTGBHHUEQUWSQ-GQCTYLIASA-N | | SMILES | C(OC1=CC=C([N+]([O-])=O)C=C1)(=O)OC1CCCCCC=C1 |t:20| |
| | (2E)-TCO-PNB ester Usage And Synthesis |
| Uses | (2E)-TCO-PNB ester is a Click Amino Acid that can be used as a linker in the synthesis of PROTAC molecules. (2E)-TCO-PNB ester contains a TCO group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing a Tetrazine group. | | References | [1] Natasha Bidesi, et al. Synthesis and radiolabeling of a polar [125 I]I-1,2,4,5-tetrazine. J Labelled Comp Radiopharm. 2023 Jan;66(1):22-30. DOI:10.1002/jlcr.4009 |
| | (2E)-TCO-PNB ester Preparation Products And Raw materials |
|