| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Di-tert-butyl 1,3-acetonedicarboxylate Basic information |
| Product Name: | Di-tert-butyl 1,3-acetonedicarboxylate | | Synonyms: | DI-TERT-BUTYL 3-OXOGLUTARATE;bis(1,1-dimethylethyl) 3-oxoglutarate;3-Oxoglutaric acid di-tert-butyl ester;3-Oxopentanedioic acid di-tert-butyl ester;Pentanedioic acid, 3-oxo-, 1,5-bis(1,1-dimethylethyl) ester;1,5-di-tert-Butyl 3-oxopentanedioate;Di-tert-butyl 1,3-acetonedicarboxylate;Di-tert-butyl 3-oxopentanedioate | | CAS: | 28009-80-5 | | MF: | C13H22O5 | | MW: | 258.31 | | EINECS: | 248-775-6 | | Product Categories: | | | Mol File: | 28009-80-5.mol |  |
| | Di-tert-butyl 1,3-acetonedicarboxylate Chemical Properties |
| Melting point | 58-60 °C (lit.) | | storage temp. | 2-8°C | | solubility | methanol: soluble1g/10 mL, clear, colorless to faintly yellow | | form | solid | | Appearance | Off-white to light yellow Solid | | BRN | 2272995 | | InChI | 1S/C13H22O5/c1-12(2,3)17-10(15)7-9(14)8-11(16)18-13(4,5)6/h7-8H2,1-6H3 | | InChIKey | KREDQIDLGFBDMQ-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)CC(=O)CC(=O)OC(C)(C)C |
| WGK Germany | 3 | | F | 21 | | Storage Class | 11 - Combustible Solids |
| | Di-tert-butyl 1,3-acetonedicarboxylate Usage And Synthesis |
| Uses | Di-tert-butyl 1,3-acetonedicarboxylate was used in the synthesis of di-tert-butyl 2,3-pentadienedioate. |
| | Di-tert-butyl 1,3-acetonedicarboxylate Preparation Products And Raw materials |
|