| Company Name: |
Hangzhou Dingyan Chem Co., LTD
|
| Tel: |
0571-87157530-8003 18267553885 |
| Email: |
sales@dingyanchem.com |
| Products Intro: |
Product Name:UDP-6-N3-Gal.2Na
CAS:868208-96-2
Purity:99% HPLC Package:5KG;2KG
|
UDP-6-azido-6-deoxy-D-Gal.2Na manufacturers
|
| | UDP-6-azido-6-deoxy-D-Gal.2Na Basic information |
| Product Name: | UDP-6-azido-6-deoxy-D-Gal.2Na | | Synonyms: | UDP-6-azido-6-deoxy-D-Gal.2Na;UDP-6-azido-6-deoxy-D-Gal;Uridine-5'-disphospho-6-azido-6-deoxy-D-galactose
disodium salt;UDP-6-N3-Gal.2Na;Uridine 5′-(trihydrogen diphosphate), P′-(6-azido-6-deoxy-α-D-galactopyranosyl) ester | | CAS: | 868208-96-2 | | MF: | C15H23N5O16P2 | | MW: | 591.32 | | EINECS: | | | Product Categories: | | | Mol File: | 868208-96-2.mol |  |
| | UDP-6-azido-6-deoxy-D-Gal.2Na Chemical Properties |
| InChIKey | YLSUUMDTTUVTGP-MLLUUDRENA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)O[C@@H]2[C@@H]([C@@H](O)[C@@H](O)[C@@H](CN=[N+]=[N-])O2)O)O[C@H]1N1C=CC(=O)NC1=O)O |&1:1,2,3,14,15,16,18,20,28,r| |
| | UDP-6-azido-6-deoxy-D-Gal.2Na Usage And Synthesis |
| Uses | UDP-6-azido-6-deoxy-D-Gal.2Na is a nucleotide analog, can be used in the synthesis of azido-sugars and labeling experiments to scrutinize the capabilities of glycosyltransferases. |
| | UDP-6-azido-6-deoxy-D-Gal.2Na Preparation Products And Raw materials |
|